2-[2-[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]hydrazinyl]-2-oxoacetic acid
| Internal ID | bd55306a-0a70-4443-a6b3-d54253450807 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Phenylalanine and derivatives |
| IUPAC Name | 2-[2-[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]hydrazinyl]-2-oxoacetic acid |
| SMILES (Canonical) | COC(=O)C(CC1=CC=CC=C1)NNC(=O)C(=O)O |
| SMILES (Isomeric) | COC(=O)[C@H](CC1=CC=CC=C1)NNC(=O)C(=O)O |
| InChI | InChI=1S/C12H14N2O5/c1-19-12(18)9(13-14-10(15)11(16)17)7-8-5-3-2-4-6-8/h2-6,9,13H,7H2,1H3,(H,14,15)(H,16,17)/t9-/m0/s1 |
| InChI Key | AGOBFCADKQZOMD-VIFPVBQESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09027155 g/mol |
| Topological Polar Surface Area (TPSA) | 105.00 Ų |
| XlogP | -0.60 |
| There are no found synonyms. |
![2D Structure of 2-[2-[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]hydrazinyl]-2-oxoacetic acid](https://plantaedb.com/storage/docs/compounds/2023/11/2-2-2s-1-methoxy-1-oxo-3-phenylpropan-2-ylhydrazinyl-2-oxoacetic-acid.jpg "2D Structure of 2-[2-[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]hydrazinyl]-2-oxoacetic acid")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.88% | 90.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.28% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.16% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.37% | 99.17% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.95% | 95.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.32% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.28% | 86.33% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 85.99% | 90.20% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 85.10% | 100.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.08% | 94.45% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 82.44% | 92.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163195243 |
| LOTUS | LTS0219144 |
| wikiData | Q105095139 |