2-[[2-[(2-Hydroxy-3-methylbutanoyl)amino]-3-methylbutanoyl]-methylamino]-4-methylpentanoic acid
| Internal ID | d217e492-7d5f-49e2-abde-a48c6663478d |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Leucine and derivatives |
| IUPAC Name | 2-[[2-[(2-hydroxy-3-methylbutanoyl)amino]-3-methylbutanoyl]-methylamino]-4-methylpentanoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C17H32N2O5/c1-9(2)8-12(17(23)24)19(7)16(22)13(10(3)4)18-15(21)14(20)11(5)6/h9-14,20H,8H2,1-7H3,(H,18,21)(H,23,24) |
| InChI Key | UKOYQMONAWKXIF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H32N2O5 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.23112213 g/mol |
| Topological Polar Surface Area (TPSA) | 107.00 Ų |
| XlogP | 2.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.36% | 98.95% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.22% | 83.82% |
| CHEMBL4072 | P07858 | Cathepsin B | 97.36% | 93.67% |
| CHEMBL3837 | P07711 | Cathepsin L | 96.14% | 96.61% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.44% | 96.09% |
| CHEMBL268 | P43235 | Cathepsin K | 91.75% | 96.85% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.08% | 93.56% |
| CHEMBL3308 | P55212 | Caspase-6 | 89.41% | 97.56% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.17% | 90.17% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.08% | 99.17% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 86.71% | 100.00% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 86.49% | 94.50% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.32% | 96.47% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.16% | 85.14% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 84.80% | 100.00% |
| CHEMBL3776 | Q14790 | Caspase-8 | 84.41% | 97.06% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 84.05% | 97.86% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 82.94% | 97.50% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 81.98% | 98.05% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.47% | 96.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.36% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 12442973 |
| LOTUS | LTS0126432 |
| wikiData | Q105274762 |