2-[(1S)-1-hydroxyethyl]-1H-quinazolin-4-one
| Internal ID | abf3c240-a6b3-47b4-aa79-7296bfc557b8 |
| Taxonomy | Organoheterocyclic compounds > Diazanaphthalenes > Benzodiazines > Quinazolines |
| IUPAC Name | 2-[(1S)-1-hydroxyethyl]-1H-quinazolin-4-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H10N2O2/c1-6(13)9-11-8-5-3-2-4-7(8)10(14)12-9/h2-6,13H,1H3,(H,11,12,14)/t6-/m0/s1 |
| InChI Key | BMBSGGZMJQTQSO-LURJTMIESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.074227566 g/mol |
| Topological Polar Surface Area (TPSA) | 61.70 Ų |
| XlogP | 0.90 |
| There are no found synonyms. |
![2D Structure of 2-[(1S)-1-hydroxyethyl]-1H-quinazolin-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/2-1s-1-hydroxyethyl-1h-quinazolin-4-one.jpg "2D Structure of 2-[(1S)-1-hydroxyethyl]-1H-quinazolin-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.82% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.96% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.22% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.04% | 99.23% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.35% | 94.75% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.15% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.18% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.70% | 98.75% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 85.71% | 90.08% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 84.61% | 88.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.54% | 94.45% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 83.02% | 92.97% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.72% | 96.67% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.26% | 94.73% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 81.21% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.34% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 11116825 |
| LOTUS | LTS0132220 |
| wikiData | Q77490422 |