2-[(1R)-1-[(2R,5R)-5-ethenyl-5-methyloxolan-2-yl]ethyl]-5-methylfuran
| Internal ID | 1def46c5-648f-475f-8f95-0cef964b5103 |
| Taxonomy | Organoheterocyclic compounds > Heteroaromatic compounds |
| IUPAC Name | 2-[(1R)-1-[(2R,5R)-5-ethenyl-5-methyloxolan-2-yl]ethyl]-5-methylfuran |
| SMILES (Canonical) | CC1=CC=C(O1)C(C)C2CCC(O2)(C)C=C |
| SMILES (Isomeric) | CC1=CC=C(O1)[C@H](C)[C@H]2CC[C@](O2)(C)C=C |
| InChI | InChI=1S/C14H20O2/c1-5-14(4)9-8-13(16-14)11(3)12-7-6-10(2)15-12/h5-7,11,13H,1,8-9H2,2-4H3/t11-,13+,14-/m0/s1 |
| InChI Key | RZQBBGYIEUNQIV-YUTCNCBUSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.146329876 g/mol |
| Topological Polar Surface Area (TPSA) | 22.40 Ų |
| XlogP | 3.30 |
| There are no found synonyms. |
![2D Structure of 2-[(1R)-1-[(2R,5R)-5-ethenyl-5-methyloxolan-2-yl]ethyl]-5-methylfuran](https://plantaedb.com/storage/docs/compounds/2023/11/2-1r-1-2r5r-5-ethenyl-5-methyloxolan-2-ylethyl-5-methylfuran.jpg "2D Structure of 2-[(1R)-1-[(2R,5R)-5-ethenyl-5-methyloxolan-2-yl]ethyl]-5-methylfuran")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.47% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.22% | 94.45% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.59% | 95.89% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 86.45% | 89.05% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.08% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.15% | 95.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.90% | 93.99% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.67% | 93.56% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.64% | 94.80% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.60% | 97.09% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.35% | 100.00% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 82.98% | 88.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.17% | 96.09% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.60% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Artemisia pallens |
| PubChem | 162954044 |
| LOTUS | LTS0079192 |
| wikiData | Q105248540 |