2-(1,3-Benzodioxol-5-yl)-8-(2-hydroxy-3-methylbut-3-enyl)-5,7-dimethoxy-2,3-dihydrochromen-4-one
Internal ID | 271be1f2-a388-4741-bd98-562825d12f0b |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > 8-prenylated flavans > 8-prenylated flavanones |
IUPAC Name | 2-(1,3-benzodioxol-5-yl)-8-(2-hydroxy-3-methylbut-3-enyl)-5,7-dimethoxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC(=C)C(CC1=C2C(=C(C=C1OC)OC)C(=O)CC(O2)C3=CC4=C(C=C3)OCO4)O |
SMILES (Isomeric) | CC(=C)C(CC1=C2C(=C(C=C1OC)OC)C(=O)CC(O2)C3=CC4=C(C=C3)OCO4)O |
InChI | InChI=1S/C23H24O7/c1-12(2)15(24)8-14-19(26-3)10-21(27-4)22-16(25)9-18(30-23(14)22)13-5-6-17-20(7-13)29-11-28-17/h5-7,10,15,18,24H,1,8-9,11H2,2-4H3 |
InChI Key | HEQLSVWMTJXPGS-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C23H24O7 |
Molecular Weight | 412.40 g/mol |
Exact Mass | 412.15220310 g/mol |
Topological Polar Surface Area (TPSA) | 83.50 Ų |
XlogP | 3.50 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.95% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.92% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.77% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.73% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 97.17% | 98.95% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 95.90% | 94.80% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 92.76% | 96.77% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.54% | 97.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 91.04% | 92.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.90% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.56% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.34% | 89.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.70% | 96.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.38% | 94.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.81% | 95.89% |
CHEMBL2535 | P11166 | Glucose transporter | 84.64% | 98.75% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.52% | 90.00% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.38% | 89.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.10% | 95.89% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.92% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.63% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.45% | 99.17% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.06% | 97.14% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 81.72% | 83.82% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pongamia pinnata |
PubChem | 85310187 |
LOTUS | LTS0177999 |
wikiData | Q105026992 |