2-(12-Aminotridecyl)pyrrolidine
| Internal ID | 64dbf8d9-fed3-4ac7-ad49-18b77e4f5bb2 |
| Taxonomy | Organoheterocyclic compounds > Pyrrolidines |
| IUPAC Name | 13-pyrrolidin-2-yltridecan-2-amine |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C17H36N2/c1-16(18)12-9-7-5-3-2-4-6-8-10-13-17-14-11-15-19-17/h16-17,19H,2-15,18H2,1H3 |
| InChI Key | LNAVQMDAZGLAPG-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C17H36N2 |
| Molecular Weight | 268.50 g/mol |
| Exact Mass | 268.287849157 g/mol |
| Topological Polar Surface Area (TPSA) | 38.10 Ų |
| XlogP | 5.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.46% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.84% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.66% | 83.82% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 93.57% | 97.79% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 93.26% | 95.58% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.22% | 94.45% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.18% | 94.75% |
| CHEMBL3837 | P07711 | Cathepsin L | 91.16% | 96.61% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.07% | 97.25% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 91.01% | 98.10% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 91.00% | 93.18% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.62% | 96.47% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.61% | 98.95% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 89.31% | 95.93% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 88.57% | 97.23% |
| CHEMBL3045 | P05771 | Protein kinase C beta | 87.15% | 97.63% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 86.78% | 97.21% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 86.59% | 96.21% |
| CHEMBL233 | P35372 | Mu opioid receptor | 86.25% | 97.93% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.28% | 93.56% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 85.18% | 98.33% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.08% | 95.50% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 85.02% | 97.29% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 84.67% | 96.67% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.51% | 100.00% |
| CHEMBL249 | P25103 | Neurokinin 1 receptor | 83.72% | 99.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.52% | 95.89% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.49% | 90.08% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.91% | 93.99% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 82.67% | 95.71% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 82.26% | 90.71% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.19% | 100.00% |
| CHEMBL236 | P41143 | Delta opioid receptor | 81.98% | 99.35% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 81.46% | 99.18% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.35% | 96.95% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 81.29% | 94.45% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.96% | 90.71% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 80.76% | 93.31% |
| CHEMBL2593 | P30419 | Peptide N-myristoyltransferase 1 | 80.29% | 93.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 85317178 |
| LOTUS | LTS0202794 |
| wikiData | Q105154246 |