2-[1-Hydroxy-6-methyl-5-(4-methylpent-3-enyl)-3,4-dioxonaphthalen-2-yl]propanal
| Internal ID | 9c413cc2-9472-4820-bcdc-e2c4d3bebd94 |
| Taxonomy | Benzenoids > Naphthalenes > Naphthoquinones |
| IUPAC Name | 2-[1-hydroxy-6-methyl-5-(4-methylpent-3-enyl)-3,4-dioxonaphthalen-2-yl]propanal |
| SMILES (Canonical) | CC1=C(C2=C(C=C1)C(=C(C(=O)C2=O)C(C)C=O)O)CCC=C(C)C |
| SMILES (Isomeric) | CC1=C(C2=C(C=C1)C(=C(C(=O)C2=O)C(C)C=O)O)CCC=C(C)C |
| InChI | InChI=1S/C20H22O4/c1-11(2)6-5-7-14-12(3)8-9-15-17(14)20(24)19(23)16(18(15)22)13(4)10-21/h6,8-10,13,22H,5,7H2,1-4H3 |
| InChI Key | ADOIZFIXVUEKRU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.15180918 g/mol |
| Topological Polar Surface Area (TPSA) | 71.40 Ų |
| XlogP | 3.40 |
| There are no found synonyms. |
![2D Structure of 2-[1-Hydroxy-6-methyl-5-(4-methylpent-3-enyl)-3,4-dioxonaphthalen-2-yl]propanal](https://plantaedb.com/storage/docs/compounds/2023/11/2-1-hydroxy-6-methyl-5-4-methylpent-3-enyl-34-dioxonaphthalen-2-ylpropanal.jpg "2D Structure of 2-[1-Hydroxy-6-methyl-5-(4-methylpent-3-enyl)-3,4-dioxonaphthalen-2-yl]propanal")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.54% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.03% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.44% | 91.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.42% | 94.73% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.91% | 96.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.10% | 89.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.13% | 90.71% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 83.37% | 96.90% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 82.40% | 91.49% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.65% | 90.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.43% | 93.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.56% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Salvia limbata |
| PubChem | 101999880 |
| LOTUS | LTS0204327 |
| wikiData | Q104909709 |