2-[1-Hydroxy-2-(4-methoxyphenyl)ethyl]-6-methoxyphenol
| Internal ID | ee163278-0d3f-41fd-8ebb-4344dad72101 |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 2-[1-hydroxy-2-(4-methoxyphenyl)ethyl]-6-methoxyphenol |
| SMILES (Canonical) | COC1=CC=C(C=C1)CC(C2=C(C(=CC=C2)OC)O)O |
| SMILES (Isomeric) | COC1=CC=C(C=C1)CC(C2=C(C(=CC=C2)OC)O)O |
| InChI | InChI=1S/C16H18O4/c1-19-12-8-6-11(7-9-12)10-14(17)13-4-3-5-15(20-2)16(13)18/h3-9,14,17-18H,10H2,1-2H3 |
| InChI Key | WMGKVJJUUWGVJC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.12050905 g/mol |
| Topological Polar Surface Area (TPSA) | 58.90 Ų |
| XlogP | 3.20 |
| There are no found synonyms. |
![2D Structure of 2-[1-Hydroxy-2-(4-methoxyphenyl)ethyl]-6-methoxyphenol](https://plantaedb.com/storage/docs/compounds/2023/11/2-1-hydroxy-2-4-methoxyphenylethyl-6-methoxyphenol.jpg "2D Structure of 2-[1-Hydroxy-2-(4-methoxyphenyl)ethyl]-6-methoxyphenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.01% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.93% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.95% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.40% | 91.11% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 91.53% | 90.20% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.56% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.44% | 85.14% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.21% | 99.17% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 87.99% | 93.31% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.89% | 98.75% |
| CHEMBL1944 | P08473 | Neprilysin | 87.08% | 92.63% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.77% | 95.89% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.37% | 95.50% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 83.70% | 90.24% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.64% | 93.99% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.48% | 99.15% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.30% | 96.00% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 81.17% | 93.81% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.83% | 90.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.24% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pellia epiphylla |
| PubChem | 101712295 |
| LOTUS | LTS0188814 |
| wikiData | Q105308531 |