2-(1-acetamidoethyl)-N-(2-phenylethyl)-1,3-thiazole-4-carboxamide
| Internal ID | d2877e7d-7f76-4be5-9018-1a76f7b6dcc6 |
| Taxonomy | Organoheterocyclic compounds > Azoles > Thiazoles > Thiazolecarboxylic acids and derivatives > Thiazolecarboxamides |
| IUPAC Name | 2-(1-acetamidoethyl)-N-(2-phenylethyl)-1,3-thiazole-4-carboxamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H19N3O2S/c1-11(18-12(2)20)16-19-14(10-22-16)15(21)17-9-8-13-6-4-3-5-7-13/h3-7,10-11H,8-9H2,1-2H3,(H,17,21)(H,18,20) |
| InChI Key | MEBSKLSELLTMAT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.11979803 g/mol |
| Topological Polar Surface Area (TPSA) | 99.30 Ų |
| XlogP | 2.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.62% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.05% | 96.09% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 93.72% | 87.67% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.39% | 94.73% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 91.18% | 81.11% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 89.00% | 89.33% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.40% | 95.50% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 87.37% | 96.67% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 86.80% | 90.20% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 86.68% | 95.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.43% | 99.17% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.12% | 90.17% |
| CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 85.49% | 95.71% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.95% | 98.75% |
| CHEMBL5028 | O14672 | ADAM10 | 83.90% | 97.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.60% | 99.23% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.46% | 91.11% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.19% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162995184 |
| LOTUS | LTS0083306 |
| wikiData | Q104171597 |