(1Z)-1-[(4-phenyldiazenylphenyl)hydrazinylidene]naphthalen-2-one
| Internal ID | 425d4ae0-a25c-4e2a-bbae-9a70a4531cc3 |
| Taxonomy | Organoheterocyclic compounds > Azobenzenes |
| IUPAC Name | (1Z)-1-[(4-phenyldiazenylphenyl)hydrazinylidene]naphthalen-2-one |
| SMILES (Canonical) | C1=CC=C(C=C1)N=NC2=CC=C(C=C2)NN=C3C(=O)C=CC4=CC=CC=C43 |
| SMILES (Isomeric) | C1=CC=C(C=C1)N=NC2=CC=C(C=C2)N/N=C/3\C(=O)C=CC4=CC=CC=C43 |
| InChI | InChI=1S/C22H16N4O/c27-21-15-10-16-6-4-5-9-20(16)22(21)26-25-19-13-11-18(12-14-19)24-23-17-7-2-1-3-8-17/h1-15,25H/b24-23?,26-22- |
| InChI Key | HTPQPMPFXUWUOT-SRURNFRUSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H16N4O |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.13241115 g/mol |
| Topological Polar Surface Area (TPSA) | 66.20 Ų |
| XlogP | 5.40 |
| There are no found synonyms. |
![2D Structure of (1Z)-1-[(4-phenyldiazenylphenyl)hydrazinylidene]naphthalen-2-one](https://plantaedb.com/storage/docs/compounds/2023/07/1z-1-4-phenyldiazenylphenylhydrazinylidenenaphthalen-2-one.jpg "2D Structure of (1Z)-1-[(4-phenyldiazenylphenyl)hydrazinylidene]naphthalen-2-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.58% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.21% | 95.56% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 92.72% | 92.51% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.01% | 91.11% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 90.23% | 83.57% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.39% | 98.95% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 86.04% | 96.67% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.83% | 93.03% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 84.93% | 94.23% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.05% | 98.75% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.18% | 95.83% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.85% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Curcuma longa |
| Gardenia jasminoides |