(1S,9R,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,5-dien-4-one
| Internal ID | b7c947d8-eb73-4ab8-8a3e-5c04558800c8 |
| Taxonomy | Organoheterocyclic compounds > Quinolizidines |
| IUPAC Name | (1S,9R,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,5-dien-4-one |
| SMILES (Canonical) | C1CCN2CC3CC(C2C1)CN4C3=CC(=O)C=C4 |
| SMILES (Isomeric) | C1CCN2C[C@@H]3C[C@@H]([C@@H]2C1)CN4C3=CC(=O)C=C4 |
| InChI | InChI=1S/C15H20N2O/c18-13-4-6-17-9-11-7-12(15(17)8-13)10-16-5-2-1-3-14(11)16/h4,6,8,11-12,14H,1-3,5,7,9-10H2/t11-,12+,14+/m1/s1 |
| InChI Key | SJRGHHOFXSLZOB-DYEKYZERSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.157563266 g/mol |
| Topological Polar Surface Area (TPSA) | 23.60 Ų |
| XlogP | 1.50 |
| There are no found synonyms. |
![2D Structure of (1S,9R,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,5-dien-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/1s9r10s-715-diazatetracyclo77102701015heptadeca-25-dien-4-one.jpg "2D Structure of (1S,9R,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,5-dien-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 96.63% | 93.40% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.60% | 98.95% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.50% | 93.99% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.52% | 94.45% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 89.16% | 90.24% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 88.83% | 93.04% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.40% | 83.82% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.80% | 97.09% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 87.11% | 93.03% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 85.98% | 94.78% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.93% | 90.71% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.40% | 95.89% |
| CHEMBL4235 | P28845 | 11-beta-hydroxysteroid dehydrogenase 1 | 85.37% | 97.98% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.69% | 95.56% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 82.49% | 91.76% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.04% | 89.62% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 80.87% | 80.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lupinus albus subsp. albus |
| Lupinus pilosus |
| PubChem | 163050009 |
| LOTUS | LTS0085157 |
| wikiData | Q105254494 |