(1S,9R,10R)-9-butyl-10-propyl-5,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-6-amine
| Internal ID | a93d4ca6-0b10-4edb-8283-4876853aedd3 |
| Taxonomy | Organoheterocyclic compounds > Diazanaphthalenes > Benzodiazines > Quinazolines |
| IUPAC Name | (1S,9R,10R)-9-butyl-10-propyl-5,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-6-amine |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C17H27N3/c1-3-5-7-13-11(6-4-2)10-12-8-9-14-15(12)16(13)20-17(18)19-14/h11-13H,3-10H2,1-2H3,(H2,18,19,20)/t11-,12+,13-/m1/s1 |
| InChI Key | KBQJFVBWVHNCEC-FRRDWIJNSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.220497874 g/mol |
| Topological Polar Surface Area (TPSA) | 51.80 Ų |
| XlogP | 4.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.82% | 96.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 96.01% | 95.93% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.59% | 97.09% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 91.68% | 89.63% |
| CHEMBL240 | Q12809 | HERG | 89.70% | 89.76% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 88.24% | 94.55% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.19% | 97.25% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 85.98% | 97.23% |
| CHEMBL3759 | Q9H3N8 | Histamine H4 receptor | 85.62% | 93.81% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.94% | 100.00% |
| CHEMBL4105838 | Q96GG9 | DCN1-like protein 1 | 83.54% | 95.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.17% | 92.94% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.08% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.98% | 99.17% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.93% | 95.50% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 82.85% | 98.46% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 80.93% | 96.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.35% | 92.62% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.24% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 16085292 |
| LOTUS | LTS0227602 |
| wikiData | Q105138472 |