(1'S,8S)-spiro[6,7-dihydro-5H-imidazo[1,2-a]pyridine-8,2'-cyclohexane]-1'-ol
Internal ID | 09bfff35-428d-4cb2-ac43-3b3faaa726d8 |
Taxonomy | Organoheterocyclic compounds > Imidazopyridines |
IUPAC Name | (1'S,8S)-spiro[6,7-dihydro-5H-imidazo[1,2-a]pyridine-8,2'-cyclohexane]-1'-ol |
SMILES (Canonical) | C1CCC2(CCCN3C2=NC=C3)C(C1)O |
SMILES (Isomeric) | C1CC[C@@]2(CCCN3C2=NC=C3)[C@H](C1)O |
InChI | InChI=1S/C12H18N2O/c15-10-4-1-2-5-12(10)6-3-8-14-9-7-13-11(12)14/h7,9-10,15H,1-6,8H2/t10-,12+/m0/s1 |
InChI Key | LAULFUSFQNMFPM-CMPLNLGQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C12H18N2O |
Molecular Weight | 206.28 g/mol |
Exact Mass | 206.141913202 g/mol |
Topological Polar Surface Area (TPSA) | 38.00 Ų |
XlogP | 1.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 95.57% | 97.53% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.84% | 96.09% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 91.38% | 90.24% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.57% | 83.82% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 88.65% | 93.10% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 87.29% | 94.78% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.19% | 92.94% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.13% | 97.09% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.97% | 93.04% |
CHEMBL2581 | P07339 | Cathepsin D | 81.87% | 98.95% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 81.31% | 98.99% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 81.11% | 98.33% |
CHEMBL1938212 | Q9UPP1 | Histone lysine demethylase PHF8 | 80.88% | 98.33% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.81% | 90.17% |
CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 80.62% | 82.86% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 80.53% | 80.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Nitraria sibirica |
PubChem | 21607733 |
LOTUS | LTS0221718 |
wikiData | Q105148958 |