(1S,8R)-1-(hydroxymethyl)-2,3,5,6,7,8-hexahydropyrrolizin-1-ol
| Internal ID | 2f8fa9fb-c165-45d6-ae30-a48b422efd04 |
| Taxonomy | Organoheterocyclic compounds > Pyrrolizidines |
| IUPAC Name | (1S,8R)-1-(hydroxymethyl)-2,3,5,6,7,8-hexahydropyrrolizin-1-ol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C8H15NO2/c10-6-8(11)3-5-9-4-1-2-7(8)9/h7,10-11H,1-6H2/t7-,8-/m1/s1 |
| InChI Key | BVBVPQCRUAZHFR-HTQZYQBOSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.110278721 g/mol |
| Topological Polar Surface Area (TPSA) | 43.70 Ų |
| XlogP | -0.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.98% | 97.25% |
| CHEMBL238 | Q01959 | Dopamine transporter | 90.33% | 95.88% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.03% | 97.09% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.66% | 95.50% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 87.55% | 98.10% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.35% | 96.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.64% | 95.89% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.90% | 91.03% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 85.30% | 96.03% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 83.27% | 100.00% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.89% | 95.83% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.52% | 91.11% |
| CHEMBL3023 | Q9NRA0 | Sphingosine kinase 2 | 82.14% | 95.61% |
| CHEMBL233 | P35372 | Mu opioid receptor | 81.34% | 97.93% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 81.20% | 99.18% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.92% | 93.04% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.36% | 90.24% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.05% | 82.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Heliotropium curassavicum |
| PubChem | 163074803 |
| LOTUS | LTS0213009 |
| wikiData | Q104946445 |