[(1S,7R,8S)-7-hydroxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl (Z)-2-methylbut-2-enoate
Internal ID | 99f45c6b-db26-4553-80f1-62b2181c491b |
Taxonomy | Organoheterocyclic compounds > Pyrrolizidines |
IUPAC Name | [(1S,7R,8S)-7-hydroxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl (Z)-2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OCC1CCN2C1C(CC2)O |
SMILES (Isomeric) | C/C=C(/C)\C(=O)OC[C@H]1CCN2[C@@H]1[C@@H](CC2)O |
InChI | InChI=1S/C13H21NO3/c1-3-9(2)13(16)17-8-10-4-6-14-7-5-11(15)12(10)14/h3,10-12,15H,4-8H2,1-2H3/b9-3-/t10-,11-,12+/m1/s1 |
InChI Key | FOWFFDPFIJUTGG-CSZIUDOQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C13H21NO3 |
Molecular Weight | 239.31 g/mol |
Exact Mass | 239.15214353 g/mol |
Topological Polar Surface Area (TPSA) | 49.80 Ų |
XlogP | 1.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.66% | 96.09% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.70% | 83.82% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.55% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 89.63% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.18% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.93% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.34% | 91.11% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 86.30% | 97.21% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.26% | 95.89% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.71% | 93.00% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.92% | 93.03% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.25% | 94.33% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 82.84% | 95.69% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.31% | 96.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.21% | 89.00% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.13% | 93.04% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 80.12% | 97.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Jacobaea aquatica |
PubChem | 162962782 |
LOTUS | LTS0172433 |
wikiData | Q104998991 |