[(1S,7R,8S)-1,7-dihydroxy-2,3,5,6,7,8-hexahydropyrrolizin-1-yl]methyl (Z)-2-methylbut-2-enoate
Internal ID | eca44359-72d2-44d3-99f1-580d8bac20f9 |
Taxonomy | Organoheterocyclic compounds > Pyrrolizidines |
IUPAC Name | [(1S,7R,8S)-1,7-dihydroxy-2,3,5,6,7,8-hexahydropyrrolizin-1-yl]methyl (Z)-2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OCC1(CCN2C1C(CC2)O)O |
SMILES (Isomeric) | C/C=C(/C)\C(=O)OC[C@@]1(CCN2[C@H]1[C@@H](CC2)O)O |
InChI | InChI=1S/C13H21NO4/c1-3-9(2)12(16)18-8-13(17)5-7-14-6-4-10(15)11(13)14/h3,10-11,15,17H,4-8H2,1-2H3/b9-3-/t10-,11+,13-/m1/s1 |
InChI Key | YVRMERSDBXNQSI-RTVMLCCYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C13H21NO4 |
Molecular Weight | 255.31 g/mol |
Exact Mass | 255.14705815 g/mol |
Topological Polar Surface Area (TPSA) | 70.00 Ų |
XlogP | 0.30 |
There are no found synonyms. |
![2D Structure of [(1S,7R,8S)-1,7-dihydroxy-2,3,5,6,7,8-hexahydropyrrolizin-1-yl]methyl (Z)-2-methylbut-2-enoate 2D Structure of [(1S,7R,8S)-1,7-dihydroxy-2,3,5,6,7,8-hexahydropyrrolizin-1-yl]methyl (Z)-2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/1s7r8s-17-dihydroxy-235678-hexahydropyrrolizin-1-ylmethyl-z-2-methylbut-2-enoate.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.60% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.58% | 97.25% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.77% | 90.17% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 87.89% | 96.38% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.56% | 95.50% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.93% | 91.11% |
CHEMBL240 | Q12809 | HERG | 85.71% | 89.76% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.43% | 82.69% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.22% | 94.45% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.10% | 93.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 85.01% | 95.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.87% | 95.89% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.08% | 91.19% |
CHEMBL5028 | O14672 | ADAM10 | 82.96% | 97.50% |
CHEMBL1871 | P10275 | Androgen Receptor | 82.95% | 96.43% |
CHEMBL2581 | P07339 | Cathepsin D | 82.07% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.76% | 97.09% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 81.28% | 95.69% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.17% | 89.00% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.48% | 90.24% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.18% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Heliotropium marifolium |
PubChem | 11777124 |
LOTUS | LTS0058831 |
wikiData | Q105365874 |