(1S,6R,8S)-1,3-dimethyl-8-propan-2-yltricyclo[4.4.0.02,7]dec-3-ene
Internal ID | 913ac636-ec40-4b33-b4f5-5818433f781d |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | (1S,6R,8S)-1,3-dimethyl-8-propan-2-yltricyclo[4.4.0.02,7]dec-3-ene |
SMILES (Canonical) | CC1=CCC2C3C1C2(CCC3C(C)C)C |
SMILES (Isomeric) | CC1=CC[C@@H]2C3C1[C@]2(CC[C@H]3C(C)C)C |
InChI | InChI=1S/C15H24/c1-9(2)11-7-8-15(4)12-6-5-10(3)14(15)13(11)12/h5,9,11-14H,6-8H2,1-4H3/t11-,12+,13?,14?,15-/m0/s1 |
InChI Key | VLXDPFLIRFYIME-DXGYCSDQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H24 |
Molecular Weight | 204.35 g/mol |
Exact Mass | 204.187800766 g/mol |
Topological Polar Surface Area (TPSA) | 0.00 Ų |
XlogP | 4.50 |
There are no found synonyms. |
![2D Structure of (1S,6R,8S)-1,3-dimethyl-8-propan-2-yltricyclo[4.4.0.02,7]dec-3-ene 2D Structure of (1S,6R,8S)-1,3-dimethyl-8-propan-2-yltricyclo[4.4.0.02,7]dec-3-ene](https://plantaedb.com/storage/docs/compounds/2023/11/1s6r8s-13-dimethyl-8-propan-2-yltricyclo440027dec-3-ene.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.88% | 97.25% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 96.30% | 94.75% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 96.02% | 85.30% |
CHEMBL1871 | P10275 | Androgen Receptor | 89.34% | 96.43% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.19% | 90.17% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.06% | 93.99% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.81% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.80% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.58% | 93.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.50% | 97.09% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.80% | 96.38% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 85.03% | 97.79% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.23% | 91.11% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.04% | 93.40% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 80.98% | 86.00% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.96% | 93.04% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.65% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 80.61% | 98.95% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 80.50% | 92.97% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.40% | 100.00% |
CHEMBL4072 | P07858 | Cathepsin B | 80.29% | 93.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artemisia xerophytica |
Bupleurum acutifolium |
Cedrela fissilis |
Cistus monspeliensis |
Elsholtzia fruticosa |
Larix sibirica |
Lippia grata |
Micromeria croatica |
Satureja montana |
Xylopia sericea |
PubChem | 84690 |
LOTUS | LTS0216620 |
wikiData | Q105288760 |