(1S,4R,5R,7R)-4,11,11-trimethyl-10-methylidenetricyclo[5.3.1.01,5]undecane
| Internal ID | 94d42731-eb64-4c2a-9bfe-83757976737b |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | (1S,4R,5R,7R)-4,11,11-trimethyl-10-methylidenetricyclo[5.3.1.01,5]undecane |
| SMILES (Canonical) | CC1CCC23C1CC(C2(C)C)CCC3=C |
| SMILES (Isomeric) | C[C@@H]1CC[C@@]23[C@@H]1C[C@H](C2(C)C)CCC3=C |
| InChI | InChI=1S/C15H24/c1-10-7-8-15-11(2)5-6-12(9-13(10)15)14(15,3)4/h10,12-13H,2,5-9H2,1,3-4H3/t10-,12-,13-,15-/m1/s1 |
| InChI Key | SLTLKLCDQWGISZ-BPGGGUHBSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 g/mol |
| Exact Mass | 204.187800766 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 5.00 |
| There are no found synonyms. |
![2D Structure of (1S,4R,5R,7R)-4,11,11-trimethyl-10-methylidenetricyclo[5.3.1.01,5]undecane](https://plantaedb.com/storage/docs/compounds/2023/11/1s4r5r7r-41111-trimethyl-10-methylidenetricyclo531015undecane.jpg "2D Structure of (1S,4R,5R,7R)-4,11,11-trimethyl-10-methylidenetricyclo[5.3.1.01,5]undecane")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.38% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.94% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.71% | 96.09% |
| CHEMBL238 | Q01959 | Dopamine transporter | 88.20% | 95.88% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.74% | 100.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.26% | 94.75% |
| CHEMBL233 | P35372 | Mu opioid receptor | 85.55% | 97.93% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 83.64% | 95.27% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.30% | 91.11% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 83.06% | 82.69% |
| CHEMBL1871 | P10275 | Androgen Receptor | 82.90% | 96.43% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 81.43% | 95.38% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 80.78% | 95.58% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.32% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Asarum epigynum |
| Citrus × aurantium |
| Helichrysum italicum subsp. picardii |
| Panax ginseng |
| Pinus sylvestris |
| Sequoiadendron giganteum |
| Valeriana phu |
| PubChem | 139587800 |
| LOTUS | LTS0237651 |
| wikiData | Q77574348 |