(1S,3R,4E,8R,12S,13E)-1,5-dimethyl-9-methylidene-12-propan-2-ylcyclotetradeca-4,13-diene-1,3,8-triol
| Internal ID | 84da3e03-c348-4d0e-b5ef-7c0229213f20 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Cembrane diterpenoids |
| IUPAC Name | (1S,3R,4E,8R,12S,13E)-1,5-dimethyl-9-methylidene-12-propan-2-ylcyclotetradeca-4,13-diene-1,3,8-triol |
| SMILES (Canonical) | CC1=CC(CC(C=CC(CCC(=C)C(CC1)O)C(C)C)(C)O)O |
| SMILES (Isomeric) | C/C/1=C\[C@@H](C[C@](/C=C/[C@@H](CCC(=C)[C@@H](CC1)O)C(C)C)(C)O)O |
| InChI | InChI=1S/C20H34O3/c1-14(2)17-8-7-16(4)19(22)9-6-15(3)12-18(21)13-20(5,23)11-10-17/h10-12,14,17-19,21-23H,4,6-9,13H2,1-3,5H3/b11-10+,15-12+/t17-,18+,19-,20-/m1/s1 |
| InChI Key | UGJGMIHFKBLYRL-WVEYWKSMSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.25079494 g/mol |
| Topological Polar Surface Area (TPSA) | 60.70 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.25% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.57% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.12% | 97.25% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.67% | 100.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.63% | 90.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.54% | 95.89% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.44% | 94.75% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.48% | 93.56% |
| CHEMBL1871 | P10275 | Androgen Receptor | 84.93% | 96.43% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.35% | 95.56% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 84.19% | 96.61% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.93% | 97.09% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.31% | 95.89% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.74% | 96.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Nicotiana tabacum |
| PubChem | 163026796 |
| LOTUS | LTS0174132 |
| wikiData | Q105272390 |