(1S,3aR,9bR)-3a-hydroxy-1,5,8-trimethyl-1,9b-dihydrobenzo[e][1]benzofuran-2-one
Internal ID | de67015d-6ab0-4969-94e1-c345294946bd |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | (1S,3aR,9bR)-3a-hydroxy-1,5,8-trimethyl-1,9b-dihydrobenzo[e][1]benzofuran-2-one |
SMILES (Canonical) | CC1C2C3=C(C=CC(=C3)C)C(=CC2(OC1=O)O)C |
SMILES (Isomeric) | C[C@H]1[C@@H]2C3=C(C=CC(=C3)C)C(=C[C@]2(OC1=O)O)C |
InChI | InChI=1S/C15H16O3/c1-8-4-5-11-9(2)7-15(17)13(12(11)6-8)10(3)14(16)18-15/h4-7,10,13,17H,1-3H3/t10-,13+,15+/m0/s1 |
InChI Key | MBTLCIPIGUKEFI-PSOPSSQASA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H16O3 |
Molecular Weight | 244.28 g/mol |
Exact Mass | 244.109944368 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 2.10 |
There are no found synonyms. |
![2D Structure of (1S,3aR,9bR)-3a-hydroxy-1,5,8-trimethyl-1,9b-dihydrobenzo[e][1]benzofuran-2-one 2D Structure of (1S,3aR,9bR)-3a-hydroxy-1,5,8-trimethyl-1,9b-dihydrobenzo[e][1]benzofuran-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/1s3ar9br-3a-hydroxy-158-trimethyl-19b-dihydrobenzoe1benzofuran-2-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.71% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.45% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 94.62% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.28% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.82% | 89.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 85.55% | 94.80% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.18% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.40% | 86.33% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 83.70% | 92.51% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.27% | 96.09% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 80.58% | 96.09% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.02% | 93.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Chromolaena laevigata |
PubChem | 163043223 |
LOTUS | LTS0184129 |
wikiData | Q105160951 |