(1S,2S,5R,8R,9R)-4,4,8-trimethyltricyclo[6.3.1.01,5]dodecane-2,9-diol
| Internal ID | a32865ee-2766-4152-a10c-ec16d9ca683b |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | (1S,2S,5R,8R,9R)-4,4,8-trimethyltricyclo[6.3.1.01,5]dodecane-2,9-diol |
| SMILES (Canonical) | CC1(CC(C23C1CCC(C2)(C(CC3)O)C)O)C |
| SMILES (Isomeric) | C[C@@]12CC[C@H]3[C@@](C1)(CC[C@H]2O)[C@H](CC3(C)C)O |
| InChI | InChI=1S/C15H26O2/c1-13(2)8-12(17)15-7-5-11(16)14(3,9-15)6-4-10(13)15/h10-12,16-17H,4-9H2,1-3H3/t10-,11-,12+,14-,15+/m1/s1 |
| InChI Key | BWXJQHJHGMZLBT-AMVBZWJASA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.193280068 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
![2D Structure of (1S,2S,5R,8R,9R)-4,4,8-trimethyltricyclo[6.3.1.01,5]dodecane-2,9-diol](https://plantaedb.com/storage/docs/compounds/2023/11/1s2s5r8r9r-448-trimethyltricyclo631015dodecane-29-diol.jpg "2D Structure of (1S,2S,5R,8R,9R)-4,4,8-trimethyltricyclo[6.3.1.01,5]dodecane-2,9-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.21% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.84% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.01% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.63% | 100.00% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.94% | 96.61% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.55% | 92.94% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 84.43% | 95.58% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 83.89% | 82.69% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 82.81% | 91.79% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 81.43% | 95.38% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.36% | 96.77% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.28% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aldama atacamensis |
| Artemisia argyi |
| Cunila lythrifolia |
| Euphorbia micractina |
| PubChem | 157487744 |
| LOTUS | LTS0261032 |
| wikiData | Q104947734 |