(1S,2R,9S,10S)-13-hydroxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one
| Internal ID | d87caa10-b2ca-47d3-804d-8d339163ad81 |
| Taxonomy | Alkaloids and derivatives > Lupin alkaloids > Sparteine, lupanine, and related alkaloids |
| IUPAC Name | (1S,2R,9S,10S)-13-hydroxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one |
| SMILES (Canonical) | C1CC2C3CC(CN2C(=O)C1)C4CCC(CN4C3)O |
| SMILES (Isomeric) | C1C[C@@H]2[C@H]3C[C@@H](CN2C(=O)C1)[C@@H]4CCC(CN4C3)O |
| InChI | InChI=1S/C15H24N2O2/c18-12-4-5-13-11-6-10(7-16(13)9-12)14-2-1-3-15(19)17(14)8-11/h10-14,18H,1-9H2/t10-,11-,12?,13-,14+/m0/s1 |
| InChI Key | JZFWYXLNISKIRH-WSOGJNRSSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.183778013 g/mol |
| Topological Polar Surface Area (TPSA) | 43.80 Ų |
| XlogP | 0.60 |
| There are no found synonyms. |
![2D Structure of (1S,2R,9S,10S)-13-hydroxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one](https://plantaedb.com/storage/docs/compounds/2023/11/1s2r9s10s-13-hydroxy-715-diazatetracyclo77102701015heptadecan-6-one.jpg "2D Structure of (1S,2R,9S,10S)-13-hydroxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.70% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.89% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.30% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.20% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.38% | 98.95% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 87.04% | 91.76% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.66% | 90.71% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.39% | 97.25% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.48% | 93.03% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 81.86% | 97.05% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 81.39% | 95.58% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.16% | 92.50% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.61% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lupinus argenteus |
| Pearsonia cajanifolia |
| PubChem | 101147721 |
| LOTUS | LTS0134003 |
| wikiData | Q104375533 |