(1S,2R,9R,10S)-10-prop-2-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecane
| Internal ID | 708064cf-0e9c-424a-a978-afa74553a4e7 |
| Taxonomy | Organoheterocyclic compounds > Quinolizidines |
| IUPAC Name | (1S,2R,9R,10S)-10-prop-2-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecane |
| SMILES (Canonical) | C=CCC1C2CC(CN1)C3CCCCN3C2 |
| SMILES (Isomeric) | C=CC[C@H]1[C@@H]2C[C@@H](CN1)[C@H]3CCCCN3C2 |
| InChI | InChI=1S/C14H24N2/c1-2-5-13-12-8-11(9-15-13)14-6-3-4-7-16(14)10-12/h2,11-15H,1,3-10H2/t11-,12+,13-,14+/m0/s1 |
| InChI Key | CPUYTANJOPKGRH-RFQIPJPRSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.35 g/mol |
| Exact Mass | 220.193948774 g/mol |
| Topological Polar Surface Area (TPSA) | 15.30 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
![2D Structure of (1S,2R,9R,10S)-10-prop-2-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecane](https://plantaedb.com/storage/docs/compounds/2023/11/1s2r9r10s-10-prop-2-enyl-711-diazatricyclo731027tridecane.jpg "2D Structure of (1S,2R,9R,10S)-10-prop-2-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecane")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.94% | 97.25% |
| CHEMBL228 | P31645 | Serotonin transporter | 96.29% | 95.51% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.68% | 97.09% |
| CHEMBL238 | Q01959 | Dopamine transporter | 91.68% | 95.88% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 89.24% | 94.78% |
| CHEMBL4235 | P28845 | 11-beta-hydroxysteroid dehydrogenase 1 | 88.96% | 97.98% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 88.56% | 98.10% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.64% | 96.09% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.30% | 89.62% |
| CHEMBL3023 | Q9NRA0 | Sphingosine kinase 2 | 87.00% | 95.61% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.92% | 95.50% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.19% | 93.04% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.86% | 95.89% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 83.05% | 94.55% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 82.94% | 98.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.66% | 94.45% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 82.32% | 91.76% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.27% | 98.95% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.13% | 93.00% |
| CHEMBL3105 | P09874 | Poly [ADP-ribose] polymerase-1 | 81.83% | 93.90% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.24% | 91.71% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.13% | 90.08% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 80.85% | 92.12% |
| CHEMBL1938212 | Q9UPP1 | Histone lysine demethylase PHF8 | 80.59% | 98.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Thermopsis mongolica |
| PubChem | 163103715 |
| LOTUS | LTS0086352 |
| wikiData | Q104967786 |