[(1S,2R,8R,8aR)-1,2-diacetyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl] acetate
| Internal ID | 08303d7e-48d6-4c2c-97eb-98c08fdb4493 |
| Taxonomy | Organoheterocyclic compounds > Indolizidines |
| IUPAC Name | [(1S,2R,8R,8aR)-1,2-diacetyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl] acetate |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C14H21NO6/c1-8(16)19-11-5-4-6-15-7-12(20-9(2)17)14(13(11)15)21-10(3)18/h11-14H,4-7H2,1-3H3/t11-,12-,13-,14-/m1/s1 |
| InChI Key | UPCYJFRRKQJZLL-AAVRWANBSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.13688739 g/mol |
| Topological Polar Surface Area (TPSA) | 82.10 Ų |
| XlogP | 0.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.97% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.45% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.98% | 94.45% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.03% | 91.19% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 85.38% | 98.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.93% | 95.89% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.72% | 92.50% |
| CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 82.20% | 98.99% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.04% | 94.33% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.02% | 100.00% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.71% | 93.04% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.60% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Astragalus oxyphysus |
| PubChem | 11822669 |
| LOTUS | LTS0137763 |
| wikiData | Q105276720 |