(-)-14,15-Dihydroxysativene
| Internal ID | 1873f83e-646d-4305-934a-afca6d9c53a6 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | (1S,2R,3R,6R,8R,9S,10R)-6-methyl-7-methylidene-3-propan-2-yltricyclo[4.4.0.02,8]decane-9,10-diol |
| SMILES (Canonical) | CC(C)C1CCC2(C3C1C(C2=C)C(C3O)O)C |
| SMILES (Isomeric) | CC(C)[C@H]1CC[C@@]2([C@@H]3[C@H]1[C@H](C2=C)[C@@H]([C@@H]3O)O)C |
| InChI | InChI=1S/C15H24O2/c1-7(2)9-5-6-15(4)8(3)10-11(9)12(15)14(17)13(10)16/h7,9-14,16-17H,3,5-6H2,1-2,4H3/t9-,10+,11-,12-,13+,14-,15+/m1/s1 |
| InChI Key | WESKDXUXCFNPHE-NRFRHTMUSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.177630004 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.49% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.28% | 90.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.34% | 91.11% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 91.05% | 83.82% |
| CHEMBL4072 | P07858 | Cathepsin B | 89.30% | 93.67% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.60% | 94.45% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.80% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.77% | 100.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.82% | 98.95% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 84.69% | 95.93% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.64% | 97.25% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 83.45% | 85.30% |
| CHEMBL1871 | P10275 | Androgen Receptor | 83.28% | 96.43% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.91% | 100.00% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 82.73% | 95.38% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.04% | 94.75% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.78% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 21635687 |
| LOTUS | LTS0214790 |
| wikiData | Q105303463 |