(1S)-6,7-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinolin-8-ol
Internal ID | 11c544c9-fb19-42bb-91aa-141961daaf33 |
Taxonomy | Organoheterocyclic compounds > Tetrahydroisoquinolines |
IUPAC Name | (1S)-6,7-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinolin-8-ol |
SMILES (Canonical) | CC1C2=C(C(=C(C=C2CCN1)OC)OC)O |
SMILES (Isomeric) | C[C@H]1C2=C(C(=C(C=C2CCN1)OC)OC)O |
InChI | InChI=1S/C12H17NO3/c1-7-10-8(4-5-13-7)6-9(15-2)12(16-3)11(10)14/h6-7,13-14H,4-5H2,1-3H3/t7-/m0/s1 |
InChI Key | PRNZAMQMBOFSJY-ZETCQYMHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C12H17NO3 |
Molecular Weight | 223.27 g/mol |
Exact Mass | 223.12084340 g/mol |
Topological Polar Surface Area (TPSA) | 50.70 Ų |
XlogP | 1.30 |
17627-77-9 |
23XP4B16AN |
(1S)-6,7-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinolin-8-ol |
ANHALONIDINE [MI] |
(+)-ANHALONIDINE |
ANHALONIDINE, (+)- |
SCHEMBL9852535 |
DTXSID60876920 |
6,7-dimethoxy-8-hydroxy-1-methyl-1,2,3,4-tetrahydroisoquinoline |
AKOS000277780 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.51% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.57% | 96.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 93.89% | 92.94% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 92.72% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.19% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.39% | 95.89% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.20% | 93.99% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.89% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.88% | 86.33% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.62% | 91.03% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.15% | 99.17% |
CHEMBL2535 | P11166 | Glucose transporter | 84.10% | 98.75% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.00% | 94.45% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.90% | 90.00% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 81.47% | 91.00% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 80.46% | 92.68% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 80.46% | 95.62% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 80.39% | 88.48% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.10% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gymnocalycium bodenbenderianum |
Gymnocalycium monvillei |
Lophophora williamsii |
Pachycereus weberi |
Turbinicarpus pseudopectinatus |
Vachellia rigidula |
PubChem | 87201 |
LOTUS | LTS0058901 |
wikiData | Q105213836 |