[(1S)-2-benzamido-1-phenylethyl] acetate
Internal ID | 5bf4f774-c39b-4c6e-87b1-c095211a6a42 |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzyloxycarbonyls |
IUPAC Name | [(1S)-2-benzamido-1-phenylethyl] acetate |
SMILES (Canonical) | CC(=O)OC(CNC(=O)C1=CC=CC=C1)C2=CC=CC=C2 |
SMILES (Isomeric) | CC(=O)O[C@H](CNC(=O)C1=CC=CC=C1)C2=CC=CC=C2 |
InChI | InChI=1S/C17H17NO3/c1-13(19)21-16(14-8-4-2-5-9-14)12-18-17(20)15-10-6-3-7-11-15/h2-11,16H,12H2,1H3,(H,18,20)/t16-/m1/s1 |
InChI Key | HFXGTOYPBVDNSI-MRXNPFEDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H17NO3 |
Molecular Weight | 283.32 g/mol |
Exact Mass | 283.12084340 g/mol |
Topological Polar Surface Area (TPSA) | 55.40 Ų |
XlogP | 2.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 96.40% | 98.95% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.62% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.15% | 96.09% |
CHEMBL240 | Q12809 | HERG | 89.33% | 89.76% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 86.86% | 87.67% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 86.81% | 81.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.73% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.46% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.19% | 94.73% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.16% | 91.11% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 83.32% | 100.00% |
CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 83.10% | 96.67% |
CHEMBL2535 | P11166 | Glucose transporter | 82.72% | 98.75% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 82.57% | 90.20% |
CHEMBL5028 | O14672 | ADAM10 | 82.10% | 97.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.05% | 96.00% |
CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 81.12% | 89.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Digitalis lanata |
Mandevilla pentlandiana |
Nerium oleander |
Oxytropis muricata |
PubChem | 14572463 |
LOTUS | LTS0077452 |
wikiData | Q105291032 |