[(1S)-1-[3-methoxy-4-(2-methylpropanoyloxy)phenyl]prop-2-enyl] 3-methylbutanoate
| Internal ID | d2b3e2ce-9bc6-4893-a788-f653bc615a56 |
| Taxonomy | Benzenoids > Phenol esters |
| IUPAC Name | [(1S)-1-[3-methoxy-4-(2-methylpropanoyloxy)phenyl]prop-2-enyl] 3-methylbutanoate |
| SMILES (Canonical) | CC(C)CC(=O)OC(C=C)C1=CC(=C(C=C1)OC(=O)C(C)C)OC |
| SMILES (Isomeric) | CC(C)CC(=O)O[C@@H](C=C)C1=CC(=C(C=C1)OC(=O)C(C)C)OC |
| InChI | InChI=1S/C19H26O5/c1-7-15(23-18(20)10-12(2)3)14-8-9-16(17(11-14)22-6)24-19(21)13(4)5/h7-9,11-13,15H,1,10H2,2-6H3/t15-/m0/s1 |
| InChI Key | ZMQPXMBRSIEPJQ-HNNXBMFYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.17802393 g/mol |
| Topological Polar Surface Area (TPSA) | 61.80 Ų |
| XlogP | 4.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.69% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.56% | 98.95% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.91% | 96.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 91.83% | 90.20% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.93% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.11% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.67% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.47% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.06% | 94.45% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.88% | 94.73% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 86.72% | 97.21% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.84% | 98.75% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.13% | 89.62% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.18% | 96.95% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.54% | 90.71% |
| CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 82.27% | 92.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.19% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cosmos pringlei |
| PubChem | 163068517 |
| LOTUS | LTS0061866 |
| wikiData | Q105379682 |