[(1S)-1-[(2R,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-methoxy-2-oxoethyl] 3,4,5-trihydroxybenzoate
| Internal ID | bdb6d377-175f-46b6-8b4a-4a8e671a98cb |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Hydroxybenzoic acid derivatives > Gallic acid and derivatives > Galloyl esters |
| IUPAC Name | [(1S)-1-[(2R,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-methoxy-2-oxoethyl] 3,4,5-trihydroxybenzoate |
| SMILES (Canonical) | COC(=O)C(C1C(C(C(=O)O1)O)O)OC(=O)C2=CC(=C(C(=C2)O)O)O |
| SMILES (Isomeric) | COC(=O)[C@H]([C@H]1[C@@H]([C@H](C(=O)O1)O)O)OC(=O)C2=CC(=C(C(=C2)O)O)O |
| InChI | InChI=1S/C14H14O11/c1-23-14(22)11(10-8(18)9(19)13(21)24-10)25-12(20)4-2-5(15)7(17)6(16)3-4/h2-3,8-11,15-19H,1H3/t8-,9-,10-,11+/m1/s1 |
| InChI Key | RQUDYYZIFCIQQF-DBIOUOCHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H14O11 |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 358.05361126 g/mol |
| Topological Polar Surface Area (TPSA) | 180.00 Ų |
| XlogP | -0.80 |
| There are no found synonyms. |
![2D Structure of [(1S)-1-[(2R,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-methoxy-2-oxoethyl] 3,4,5-trihydroxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/1s-1-2r3r4r-34-dihydroxy-5-oxooxolan-2-yl-2-methoxy-2-oxoethyl-345-trihydroxybenzoate.jpg "2D Structure of [(1S)-1-[(2R,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-methoxy-2-oxoethyl] 3,4,5-trihydroxybenzoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.66% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.81% | 99.17% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.71% | 90.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.02% | 89.00% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 84.81% | 83.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.72% | 98.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.33% | 96.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.28% | 94.73% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.15% | 94.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.23% | 99.23% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 83.08% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.85% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.82% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.87% | 95.56% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.43% | 94.33% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.14% | 86.33% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.11% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Phyllanthus emblica |
| PubChem | 162888195 |
| LOTUS | LTS0056878 |
| wikiData | Q105243625 |