(1S)-1-[(1R)-7-bromo-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-methyl-2-phenylethanamine
| Internal ID | e7e8747a-041b-4f38-a1f9-6641caedb7c9 |
| Taxonomy | Alkaloids and derivatives > Harmala alkaloids |
| IUPAC Name | (1S)-1-[(1R)-7-bromo-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-methyl-2-phenylethanamine |
| SMILES (Canonical) | CNC(CC1=CC=CC=C1)C2C3=C(CCN2C)C4=C(N3)C=C(C=C4)Br |
| SMILES (Isomeric) | CN[C@@H](CC1=CC=CC=C1)[C@@H]2C3=C(CCN2C)C4=C(N3)C=C(C=C4)Br |
| InChI | InChI=1S/C21H24BrN3/c1-23-19(12-14-6-4-3-5-7-14)21-20-17(10-11-25(21)2)16-9-8-15(22)13-18(16)24-20/h3-9,13,19,21,23-24H,10-12H2,1-2H3/t19-,21+/m0/s1 |
| InChI Key | GQLYEEKJRNBWHO-PZJWPPBQSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C21H24BrN3 |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 397.11536 g/mol |
| Topological Polar Surface Area (TPSA) | 31.10 Ų |
| XlogP | 4.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.80% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.55% | 96.09% |
| CHEMBL240 | Q12809 | HERG | 98.49% | 89.76% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.66% | 91.49% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.83% | 94.45% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 94.80% | 95.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.34% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 93.34% | 98.75% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 92.25% | 93.40% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.42% | 90.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.23% | 95.89% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 89.80% | 95.00% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 88.77% | 91.71% |
| CHEMBL4072 | P07858 | Cathepsin B | 88.48% | 93.67% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 87.17% | 95.34% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.94% | 93.99% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.79% | 89.62% |
| CHEMBL3837 | P07711 | Cathepsin L | 86.20% | 96.61% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.14% | 91.11% |
| CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 86.04% | 80.33% |
| CHEMBL1991 | O14920 | Inhibitor of nuclear factor kappa B kinase beta subunit | 85.43% | 97.15% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 84.31% | 97.00% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 83.43% | 93.81% |
| CHEMBL2327 | P21452 | Neurokinin 2 receptor | 82.86% | 98.89% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 82.67% | 94.23% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.53% | 90.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 82.30% | 98.59% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 81.90% | 90.71% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 81.78% | 98.33% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 80.39% | 97.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 46911004 |
| LOTUS | LTS0091800 |
| wikiData | Q105115228 |