(1R,9S,12S)-1,5,9,12-tetramethyl-8-oxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene
| Internal ID | d5dbb3e0-ae02-47e3-bd3f-e839875878b1 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans |
| IUPAC Name | (1R,9S,12S)-1,5,9,12-tetramethyl-8-oxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
| SMILES (Canonical) | CC1C2(CCC1(OC3=C2C=CC(=C3)C)C)C |
| SMILES (Isomeric) | C[C@H]1[C@]2(CC[C@@]1(OC3=C2C=CC(=C3)C)C)C |
| InChI | InChI=1S/C15H20O/c1-10-5-6-12-13(9-10)16-15(4)8-7-14(12,3)11(15)2/h5-6,9,11H,7-8H2,1-4H3/t11-,14+,15-/m0/s1 |
| InChI Key | KTFYXLCHBBZWNO-GLQYFDAESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.151415257 g/mol |
| Topological Polar Surface Area (TPSA) | 9.20 Ų |
| XlogP | 4.20 |
| There are no found synonyms. |
![2D Structure of (1R,9S,12S)-1,5,9,12-tetramethyl-8-oxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene](https://plantaedb.com/storage/docs/compounds/2023/11/1r9s12s-15912-tetramethyl-8-oxatricyclo721027dodeca-2735-triene.jpg "2D Structure of (1R,9S,12S)-1,5,9,12-tetramethyl-8-oxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL240 | Q12809 | HERG | 97.61% | 89.76% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.77% | 91.11% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 93.82% | 94.80% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.08% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.02% | 96.09% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 89.20% | 86.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.41% | 93.99% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 87.77% | 85.30% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.86% | 93.40% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.30% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.45% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.94% | 98.95% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 83.00% | 100.00% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.33% | 93.18% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.25% | 89.62% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.99% | 90.24% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.26% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 15765204 |
| LOTUS | LTS0188038 |
| wikiData | Q105145774 |