(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-12-one
Internal ID | 82abcbe1-c21f-421d-9335-5641a447feb1 |
Taxonomy | Alkaloids and derivatives > Morphinans |
IUPAC Name | (1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-12-one |
SMILES (Canonical) | C1CC23CCNC(C2CC1=O)CC4=CC=CC=C34 |
SMILES (Isomeric) | C1C[C@@]23CCN[C@@H]([C@@H]2CC1=O)CC4=CC=CC=C34 |
InChI | InChI=1S/C16H19NO/c18-12-5-6-16-7-8-17-15(14(16)10-12)9-11-3-1-2-4-13(11)16/h1-4,14-15,17H,5-10H2/t14-,15+,16-/m0/s1 |
InChI Key | KQSNKJUQYTZKHT-XHSDSOJGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H19NO |
Molecular Weight | 241.33 g/mol |
Exact Mass | 241.146664230 g/mol |
Topological Polar Surface Area (TPSA) | 29.10 Ų |
XlogP | 1.90 |
There are no found synonyms. |
![2D Structure of (1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-12-one 2D Structure of (1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-12-one](https://plantaedb.com/storage/docs/compounds/2023/11/1r9r10r-17-azatetracyclo7530110027heptadeca-246-trien-12-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.41% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.64% | 97.09% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.45% | 93.99% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.35% | 95.56% |
CHEMBL228 | P31645 | Serotonin transporter | 90.81% | 95.51% |
CHEMBL2581 | P07339 | Cathepsin D | 87.98% | 98.95% |
CHEMBL222 | P23975 | Norepinephrine transporter | 85.74% | 96.06% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.16% | 96.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.66% | 99.23% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.87% | 100.00% |
CHEMBL238 | Q01959 | Dopamine transporter | 81.44% | 95.88% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 81.30% | 95.62% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 81.18% | 92.67% |
CHEMBL233 | P35372 | Mu opioid receptor | 80.53% | 97.93% |
CHEMBL5028 | O14672 | ADAM10 | 80.10% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dehaasia longipedicellata |
PubChem | 54008663 |
LOTUS | LTS0201918 |
wikiData | Q105144770 |