(1R,8S,10R)-5,11,11-trimethyl-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2(7),3,5-trien-4-ol
| Internal ID | 53500ace-05e5-48af-8bc4-99f3940a9ba8 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives |
| IUPAC Name | (1R,8S,10R)-5,11,11-trimethyl-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2(7),3,5-trien-4-ol |
| SMILES (Canonical) | CC1=CC2=C(C=C1O)C34CCCC(C3CC2OC4)(C)C |
| SMILES (Isomeric) | CC1=CC2=C(C=C1O)[C@@]34CCCC([C@H]3C[C@@H]2OC4)(C)C |
| InChI | InChI=1S/C18H24O2/c1-11-7-12-13(8-14(11)19)18-6-4-5-17(2,3)16(18)9-15(12)20-10-18/h7-8,15-16,19H,4-6,9-10H2,1-3H3/t15-,16+,18-/m0/s1 |
| InChI Key | RHXIVZRYHFCBDN-JZXOWHBKSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.177630004 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 4.20 |
| There are no found synonyms. |
![2D Structure of (1R,8S,10R)-5,11,11-trimethyl-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2(7),3,5-trien-4-ol](https://plantaedb.com/storage/docs/compounds/2023/11/1r8s10r-51111-trimethyl-16-oxatetracyclo6620110027hexadeca-2735-trien-4-ol.jpg "2D Structure of (1R,8S,10R)-5,11,11-trimethyl-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2(7),3,5-trien-4-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.63% | 91.11% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.70% | 92.94% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.57% | 93.40% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.24% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.82% | 97.09% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 87.21% | 91.79% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.59% | 100.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.65% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.27% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.16% | 86.33% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 83.15% | 90.24% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.87% | 98.95% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.74% | 90.71% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.60% | 94.75% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.53% | 99.15% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 80.63% | 90.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Salvia przewalskii |
| PubChem | 138113846 |
| LOTUS | LTS0163438 |
| wikiData | Q105236674 |