(1R,8R,14R,17S)-5,12-dimethyl-5,9-diazatetracyclo[8.7.0.01,14.08,17]heptadeca-9,11-dien-16-one
| Internal ID | 64549d7f-48b2-4aef-a75c-ad3c62689836 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives |
| IUPAC Name | (1R,8R,14R,17S)-5,12-dimethyl-5,9-diazatetracyclo[8.7.0.01,14.08,17]heptadeca-9,11-dien-16-one |
| SMILES (Canonical) | CC1=CC2=NC3CCN(CCCC24C3C(=O)CC4C1)C |
| SMILES (Isomeric) | CC1=CC2=N[C@@H]3CCN(CCC[C@@]24[C@@H]3C(=O)C[C@H]4C1)C |
| InChI | InChI=1S/C17H24N2O/c1-11-8-12-10-14(20)16-13-4-7-19(2)6-3-5-17(12,16)15(9-11)18-13/h9,12-13,16H,3-8,10H2,1-2H3/t12-,13-,16+,17+/m1/s1 |
| InChI Key | NZKBZKCUTLIPCD-OMNBBPDLSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.188863393 g/mol |
| Topological Polar Surface Area (TPSA) | 32.70 Ų |
| XlogP | 0.70 |
| There are no found synonyms. |
![2D Structure of (1R,8R,14R,17S)-5,12-dimethyl-5,9-diazatetracyclo[8.7.0.01,14.08,17]heptadeca-9,11-dien-16-one](https://plantaedb.com/storage/docs/compounds/2023/11/1r8r14r17s-512-dimethyl-59-diazatetracyclo87001140817heptadeca-911-dien-16-one.jpg "2D Structure of (1R,8R,14R,17S)-5,12-dimethyl-5,9-diazatetracyclo[8.7.0.01,14.08,17]heptadeca-9,11-dien-16-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.15% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.95% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.81% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.50% | 97.25% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.91% | 93.40% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 90.77% | 94.78% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.77% | 95.89% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 88.71% | 86.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.11% | 99.23% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.66% | 90.71% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 87.17% | 93.03% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.10% | 100.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.60% | 94.75% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.35% | 93.04% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 84.30% | 90.24% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 83.37% | 92.97% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 82.64% | 99.18% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.54% | 93.65% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.86% | 94.00% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.20% | 91.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162873189 |
| LOTUS | LTS0150115 |
| wikiData | Q105188158 |