(1R,7S,8S)-7-(hydroxymethyl)-1,2,3,5,6,8-hexahydropyrrolizine-1,7-diol
Internal ID | 6c18edc2-e40b-4217-a7d8-5f1415eec05f |
Taxonomy | Organoheterocyclic compounds > Pyrrolizidines |
IUPAC Name | (1R,7S,8S)-7-(hydroxymethyl)-1,2,3,5,6,8-hexahydropyrrolizine-1,7-diol |
SMILES (Canonical) | C1CN2CCC(C2C1O)(CO)O |
SMILES (Isomeric) | C1CN2CC[C@]([C@@H]2[C@@H]1O)(CO)O |
InChI | InChI=1S/C8H15NO3/c10-5-8(12)2-4-9-3-1-6(11)7(8)9/h6-7,10-12H,1-5H2/t6-,7+,8-/m1/s1 |
InChI Key | NGWMXODAPSOEMX-GJMOJQLCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C8H15NO3 |
Molecular Weight | 173.21 g/mol |
Exact Mass | 173.10519334 g/mol |
Topological Polar Surface Area (TPSA) | 63.90 Ų |
XlogP | -1.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 94.07% | 83.82% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.35% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.49% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.44% | 97.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 86.96% | 95.93% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.59% | 95.50% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.14% | 91.11% |
CHEMBL237 | P41145 | Kappa opioid receptor | 85.39% | 98.10% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 85.16% | 95.83% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.01% | 90.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.98% | 95.89% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 84.88% | 92.86% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.73% | 91.03% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.27% | 94.45% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 82.37% | 94.66% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 82.31% | 100.00% |
CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 82.03% | 92.50% |
CHEMBL233 | P35372 | Mu opioid receptor | 81.58% | 97.93% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.49% | 90.24% |
CHEMBL238 | Q01959 | Dopamine transporter | 81.40% | 95.88% |
CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 80.76% | 92.38% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 80.38% | 92.32% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 80.19% | 97.47% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.13% | 96.61% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Heliotropium bracteatum |
PubChem | 101664494 |
LOTUS | LTS0096368 |
wikiData | Q105179219 |