(1R,7S,8R,9R,10S)-8-ethyl-4'-methylspiro[2-azatricyclo[5.5.0.02,10]dodecane-9,5'-furan]-2'-one
Internal ID | 666210a9-2d42-4466-b0ec-151bbcf999e6 |
Taxonomy | Organoheterocyclic compounds > Azaspirodecane derivatives |
IUPAC Name | (1R,7S,8R,9R,10S)-8-ethyl-4'-methylspiro[2-azatricyclo[5.5.0.02,10]dodecane-9,5'-furan]-2'-one |
SMILES (Canonical) | CCC1C2CCCCN3C2CCC3C14C(=CC(=O)O4)C |
SMILES (Isomeric) | CC[C@@H]1[C@@H]2CCCCN3[C@@H]2CC[C@H]3[C@]14C(=CC(=O)O4)C |
InChI | InChI=1S/C17H25NO2/c1-3-13-12-6-4-5-9-18-14(12)7-8-15(18)17(13)11(2)10-16(19)20-17/h10,12-15H,3-9H2,1-2H3/t12-,13+,14+,15-,17-/m0/s1 |
InChI Key | WIUBMPWTSHLPJT-CLBVLKOUSA-N |
Popularity | 3 references in papers |
Molecular Formula | C17H25NO2 |
Molecular Weight | 275.40 g/mol |
Exact Mass | 275.188529040 g/mol |
Topological Polar Surface Area (TPSA) | 29.50 Ų |
XlogP | 2.70 |
There are no found synonyms. |
![2D Structure of (1R,7S,8R,9R,10S)-8-ethyl-4'-methylspiro[2-azatricyclo[5.5.0.02,10]dodecane-9,5'-furan]-2'-one 2D Structure of (1R,7S,8R,9R,10S)-8-ethyl-4'-methylspiro[2-azatricyclo[5.5.0.02,10]dodecane-9,5'-furan]-2'-one](https://plantaedb.com/storage/docs/compounds/2023/11/1r7s8r9r10s-8-ethyl-4-methylspiro2-azatricyclo5500210dodecane-95-furan-2-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.02% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 96.20% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.42% | 96.09% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 90.29% | 89.63% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 89.78% | 93.04% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.55% | 95.56% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 88.91% | 94.78% |
CHEMBL1871 | P10275 | Androgen Receptor | 88.81% | 96.43% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.79% | 97.09% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 87.52% | 86.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.29% | 93.40% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.90% | 95.89% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.55% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Stemona parviflora |
PubChem | 102276873 |
LOTUS | LTS0222764 |
wikiData | Q105306528 |