[(1R,6R,8R,9E)-4,13-dimethyl-2-oxo-13-azatricyclo[7.7.0.01,6]hexadeca-3,9-dien-8-yl] acetate
| Internal ID | 4994e7ee-4574-40f1-a6b9-39a3c7169558 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Cyclic ketones > Cyclohexenones |
| IUPAC Name | [(1R,6R,8R,9E)-4,13-dimethyl-2-oxo-13-azatricyclo[7.7.0.01,6]hexadeca-3,9-dien-8-yl] acetate |
| SMILES (Canonical) | CC1=CC(=O)C23CCCN(CCC=C2C(CC3C1)OC(=O)C)C |
| SMILES (Isomeric) | CC1=CC(=O)[C@@]/23CCCN(CC/C=C2/[C@@H](C[C@H]3C1)OC(=O)C)C |
| InChI | InChI=1S/C19H27NO3/c1-13-10-15-12-17(23-14(2)21)16-6-4-8-20(3)9-5-7-19(15,16)18(22)11-13/h6,11,15,17H,4-5,7-10,12H2,1-3H3/b16-6-/t15-,17-,19-/m1/s1 |
| InChI Key | LNHSQQAPPKUUCZ-JWIBPDAWSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.19909372 g/mol |
| Topological Polar Surface Area (TPSA) | 46.60 Ų |
| XlogP | 1.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.46% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.12% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.80% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.80% | 97.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.72% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.39% | 91.11% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 90.50% | 93.04% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.46% | 90.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.20% | 99.23% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 86.75% | 91.03% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.61% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.55% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.59% | 86.33% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 84.17% | 93.40% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 82.10% | 91.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.34% | 95.89% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.74% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162866532 |
| LOTUS | LTS0130255 |
| wikiData | Q105154345 |