(1R,4Z,9R)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene
Internal ID | ebb0f692-f284-4945-88c6-329950576ea1 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | (1R,4Z,9R)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene |
SMILES (Canonical) | CC1=CCCC(=C)C2CC(C2CC1)(C)C |
SMILES (Isomeric) | C/C/1=C/CCC(=C)[C@@H]2CC([C@@H]2CC1)(C)C |
InChI | InChI=1S/C15H24/c1-11-6-5-7-12(2)13-10-15(3,4)14(13)9-8-11/h6,13-14H,2,5,7-10H2,1,3-4H3/b11-6-/t13-,14+/m0/s1 |
InChI Key | NPNUFJAVOOONJE-ULKYWBSGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H24 |
Molecular Weight | 204.35 g/mol |
Exact Mass | 204.187800766 g/mol |
Topological Polar Surface Area (TPSA) | 0.00 Ų |
XlogP | 4.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor |
150 nM |
Ki |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.52% | 91.11% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.49% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.15% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.16% | 96.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.53% | 92.94% |
CHEMBL1871 | P10275 | Androgen Receptor | 85.12% | 96.43% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.93% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.93% | 95.56% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.96% | 93.40% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.36% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dacrydium cupressinum |
Pinus koraiensis |
PubChem | 5498519 |
LOTUS | LTS0159030 |
wikiData | Q105183233 |