(1R,4S,5R,8S,9S)-4,11,11-trimethylspiro[bicyclo[7.2.0]undecane-8,2'-oxirane]-4,5-diol
| Internal ID | c85e457c-81ec-46ed-8ddb-70d86affeca2 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Alcohols and polyols > Tertiary alcohols |
| IUPAC Name | (1R,4S,5R,8S,9S)-4,11,11-trimethylspiro[bicyclo[7.2.0]undecane-8,2'-oxirane]-4,5-diol |
| SMILES (Canonical) | CC1(CC2C1CCC(C(CCC23CO3)O)(C)O)C |
| SMILES (Isomeric) | C[C@@]1(CC[C@@H]2[C@H](CC2(C)C)[C@@]3(CC[C@H]1O)CO3)O |
| InChI | InChI=1S/C15H26O3/c1-13(2)8-11-10(13)4-6-14(3,17)12(16)5-7-15(11)9-18-15/h10-12,16-17H,4-9H2,1-3H3/t10-,11+,12-,14+,15-/m1/s1 |
| InChI Key | SVOCNODFKUMEIY-FMKNKJFCSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.18819469 g/mol |
| Topological Polar Surface Area (TPSA) | 53.00 Ų |
| XlogP | 1.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.35% | 97.25% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.62% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.73% | 96.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.54% | 100.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 89.94% | 95.93% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.70% | 91.11% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.58% | 92.94% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.31% | 97.09% |
| CHEMBL1871 | P10275 | Androgen Receptor | 85.96% | 96.43% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 84.26% | 97.28% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 83.87% | 89.05% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.79% | 82.69% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 82.72% | 95.38% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.70% | 95.89% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.49% | 91.03% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.19% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Sindora sumatrana |
| PubChem | 11777094 |
| LOTUS | LTS0081356 |
| wikiData | Q105262276 |