(1R,3S,5R,6S,10S)-5,12,12-trimethyl-9-methylidene-4-oxatricyclo[8.2.0.03,5]dodecan-6-ol
| Internal ID | a5516740-2b09-4272-a2f3-59308c57de29 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Alcohols and polyols > Cyclic alcohols and derivatives |
| IUPAC Name | (1R,3S,5R,6S,10S)-5,12,12-trimethyl-9-methylidene-4-oxatricyclo[8.2.0.03,5]dodecan-6-ol |
| SMILES (Canonical) | CC1(CC2C1CC3C(O3)(C(CCC2=C)O)C)C |
| SMILES (Isomeric) | C[C@@]12[C@H](CCC(=C)[C@H]3CC([C@@H]3C[C@@H]1O2)(C)C)O |
| InChI | InChI=1S/C15H24O2/c1-9-5-6-12(16)15(4)13(17-15)7-11-10(9)8-14(11,2)3/h10-13,16H,1,5-8H2,2-4H3/t10-,11-,12+,13+,15-/m1/s1 |
| InChI Key | LPNFWWBDWLFIFV-DGMCESFYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.177630004 g/mol |
| Topological Polar Surface Area (TPSA) | 32.80 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.19% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.81% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.32% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.66% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.51% | 100.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.53% | 97.25% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.99% | 92.94% |
| CHEMBL1871 | P10275 | Androgen Receptor | 83.70% | 96.43% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.16% | 95.89% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 82.76% | 95.38% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 81.54% | 95.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Sindora sumatrana |
| PubChem | 10354120 |
| LOTUS | LTS0123866 |
| wikiData | Q105155271 |