(1R,3R)-3-(2-hydroperoxypropan-2-yl)-5-methoxy-1,3,4,6-tetrahydropyrano[4,3-b]carbazol-1-ol
Internal ID | 60dec807-9ea3-4dd6-b3b4-a390f5d28865 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
IUPAC Name | (1R,3R)-3-(2-hydroperoxypropan-2-yl)-5-methoxy-1,3,4,6-tetrahydropyrano[4,3-b]carbazol-1-ol |
SMILES (Canonical) | CC(C)(C1CC2=C(C=C3C4=CC=CC=C4NC3=C2OC)C(O1)O)OO |
SMILES (Isomeric) | CC(C)([C@H]1CC2=C(C=C3C4=CC=CC=C4NC3=C2OC)[C@@H](O1)O)OO |
InChI | InChI=1S/C19H21NO5/c1-19(2,25-22)15-9-12-13(18(21)24-15)8-11-10-6-4-5-7-14(10)20-16(11)17(12)23-3/h4-8,15,18,20-22H,9H2,1-3H3/t15-,18-/m1/s1 |
InChI Key | HRTBXFLBERHBPF-CRAIPNDOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H21NO5 |
Molecular Weight | 343.40 g/mol |
Exact Mass | 343.14197277 g/mol |
Topological Polar Surface Area (TPSA) | 83.90 Ų |
XlogP | 2.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL240 | Q12809 | HERG | 99.68% | 89.76% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.39% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.43% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.75% | 85.14% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.17% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.06% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.60% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 90.47% | 98.95% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 90.23% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.21% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.18% | 86.33% |
CHEMBL2535 | P11166 | Glucose transporter | 89.24% | 98.75% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.01% | 94.73% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.84% | 93.99% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.09% | 97.09% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 85.81% | 97.31% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.20% | 97.25% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.66% | 92.62% |
CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 84.51% | 98.21% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 83.94% | 93.65% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.45% | 92.94% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.96% | 97.14% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 81.20% | 92.98% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.07% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.01% | 99.17% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 80.28% | 96.39% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Clausena lansium |
PubChem | 163190959 |
LOTUS | LTS0114709 |
wikiData | Q105032826 |