(1R,2S,4S)-2-[(3E)-3,8-dimethylnona-3,7-dienyl]-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptane
| Internal ID | c0c7e8f7-1be2-4985-b3cc-c7e041125f1e |
| Taxonomy | Organoheterocyclic compounds > Tetrahydrofurans |
| IUPAC Name | (1R,2S,4S)-2-[(3E)-3,8-dimethylnona-3,7-dienyl]-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptane |
| SMILES (Canonical) | CC(=CCCC=C(C)CCC1C(C2CCC1(O2)C)(C)C)C |
| SMILES (Isomeric) | CC(=CCC/C=C(\C)/CC[C@@H]1[C@]2(CC[C@@H](C1(C)C)O2)C)C |
| InChI | InChI=1S/C20H34O/c1-15(2)9-7-8-10-16(3)11-12-17-19(4,5)18-13-14-20(17,6)21-18/h9-10,17-18H,7-8,11-14H2,1-6H3/b16-10+/t17-,18-,20+/m0/s1 |
| InChI Key | AQSIUPQOWSEZOG-JZKNUJGNSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.260965704 g/mol |
| Topological Polar Surface Area (TPSA) | 9.20 Ų |
| XlogP | 6.30 |
| There are no found synonyms. |
![2D Structure of (1R,2S,4S)-2-[(3E)-3,8-dimethylnona-3,7-dienyl]-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptane](https://plantaedb.com/storage/docs/compounds/2023/11/1r2s4s-2-3e-38-dimethylnona-37-dienyl-133-trimethyl-7-oxabicyclo221heptane.jpg "2D Structure of (1R,2S,4S)-2-[(3E)-3,8-dimethylnona-3,7-dienyl]-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptane")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.72% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.44% | 90.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.96% | 96.09% |
| CHEMBL233 | P35372 | Mu opioid receptor | 88.82% | 97.93% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.14% | 94.45% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.08% | 95.50% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.59% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.77% | 97.09% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.94% | 92.62% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 81.93% | 96.61% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.73% | 95.89% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.91% | 97.50% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 80.65% | 95.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Nassauvia argentea |
| PubChem | 162941184 |
| LOTUS | LTS0127777 |
| wikiData | Q104917034 |