(1R,2S,4R,6R,7S,8S)-1-methyl-3-methylidene-8-propan-2-yltricyclo[4.4.0.02,7]decan-4-ol
| Internal ID | 0a0edbed-bc98-40fc-9999-628411dea07a |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | (1R,2S,4R,6R,7S,8S)-1-methyl-3-methylidene-8-propan-2-yltricyclo[4.4.0.02,7]decan-4-ol |
| SMILES (Canonical) | CC(C)C1CCC2(C3C1C2C(=C)C(C3)O)C |
| SMILES (Isomeric) | CC(C)[C@@H]1CC[C@@]2([C@H]3[C@H]1[C@@H]2C(=C)[C@@H](C3)O)C |
| InChI | InChI=1S/C15H24O/c1-8(2)10-5-6-15(4)11-7-12(16)9(3)14(15)13(10)11/h8,10-14,16H,3,5-7H2,1-2,4H3/t10-,11+,12+,13-,14-,15+/m0/s1 |
| InChI Key | LPXOPRGPLUWGKB-VRPMWHRCSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 g/mol |
| Exact Mass | 220.182715385 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 3.40 |
| CHEMBL518105 |
![2D Structure of (1R,2S,4R,6R,7S,8S)-1-methyl-3-methylidene-8-propan-2-yltricyclo[4.4.0.02,7]decan-4-ol](https://plantaedb.com/storage/docs/compounds/2023/11/1r2s4r6r7s8s-1-methyl-3-methylidene-8-propan-2-yltricyclo440027decan-4-ol.jpg "2D Structure of (1R,2S,4R,6R,7S,8S)-1-methyl-3-methylidene-8-propan-2-yltricyclo[4.4.0.02,7]decan-4-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 96.55% | 94.75% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.07% | 97.25% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.65% | 90.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.55% | 96.09% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.68% | 82.69% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 89.33% | 97.79% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.11% | 96.61% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.16% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.07% | 91.11% |
| CHEMBL1871 | P10275 | Androgen Receptor | 87.74% | 96.43% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.63% | 100.00% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 85.43% | 85.30% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 83.18% | 96.38% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 82.13% | 95.93% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.10% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Marsupella aquatica |
| PubChem | 44584340 |
| LOTUS | LTS0133050 |
| wikiData | Q104394959 |