(1R,2S,4R)-2-(6-chloropyridin-3-yl)-7-azabicyclo[2.2.1]heptane
| Internal ID | be2cc36f-b1ed-44f1-80fe-262791ae9fe8 |
| Taxonomy | Alkaloids and derivatives > Epibatidine analogues |
| IUPAC Name | (1R,2S,4R)-2-(6-chloropyridin-3-yl)-7-azabicyclo[2.2.1]heptane |
| SMILES (Canonical) | C1CC2C(CC1N2)C3=CN=C(C=C3)Cl |
| SMILES (Isomeric) | C1C[C@@H]2[C@@H](C[C@@H]1N2)C3=CN=C(C=C3)Cl |
| InChI | InChI=1S/C11H13ClN2/c12-11-4-1-7(6-13-11)9-5-8-2-3-10(9)14-8/h1,4,6,8-10,14H,2-3,5H2/t8-,9+,10-/m1/s1 |
| InChI Key | NLPRAJRHRHZCQQ-KXUCPTDWSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C11H13ClN2 |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.0767261 g/mol |
| Topological Polar Surface Area (TPSA) | 24.90 Ų |
| XlogP | 2.20 |
| Atomic LogP (AlogP) | 2.34 |
| H-Bond Acceptor | 2 |
| H-Bond Donor | 1 |
| Rotatable Bonds | 1 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 1.0000 | 100.00% |
| Caco-2 | + | 0.7330 | 73.30% |
| Blood Brain Barrier | + | 0.9250 | 92.50% |
| Human oral bioavailability | + | 0.5857 | 58.57% |
| Subcellular localzation | Mitochondria | 0.5697 | 56.97% |
| OATP2B1 inhibitior | - | 0.8637 | 86.37% |
| OATP1B1 inhibitior | + | 0.9526 | 95.26% |
| OATP1B3 inhibitior | + | 0.9468 | 94.68% |
| MATE1 inhibitior | - | 0.8800 | 88.00% |
| OCT2 inhibitior | + | 0.5250 | 52.50% |
| BSEP inhibitior | - | 0.9112 | 91.12% |
| P-glycoprotein inhibitior | - | 0.9819 | 98.19% |
| P-glycoprotein substrate | - | 0.8679 | 86.79% |
| CYP3A4 substrate | - | 0.5089 | 50.89% |
| CYP2C9 substrate | - | 0.6206 | 62.06% |
| CYP2D6 substrate | + | 0.4085 | 40.85% |
| CYP3A4 inhibition | - | 0.8309 | 83.09% |
| CYP2C9 inhibition | - | 0.9071 | 90.71% |
| CYP2C19 inhibition | - | 0.9025 | 90.25% |
| CYP2D6 inhibition | - | 0.9231 | 92.31% |
| CYP1A2 inhibition | - | 0.7682 | 76.82% |
| CYP2C8 inhibition | - | 0.5632 | 56.32% |
| CYP inhibitory promiscuity | + | 0.6843 | 68.43% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.7818 | 78.18% |
| Carcinogenicity (trinary) | Non-required | 0.7826 | 78.26% |
| Eye corrosion | - | 0.9561 | 95.61% |
| Eye irritation | - | 0.9434 | 94.34% |
| Skin irritation | - | 0.6766 | 67.66% |
| Skin corrosion | - | 0.8151 | 81.51% |
| Ames mutagenesis | - | 0.7300 | 73.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7285 | 72.85% |
| Micronuclear | - | 0.5200 | 52.00% |
| Hepatotoxicity | + | 0.6927 | 69.27% |
| skin sensitisation | - | 0.8025 | 80.25% |
| Respiratory toxicity | + | 0.6667 | 66.67% |
| Reproductive toxicity | + | 0.8111 | 81.11% |
| Mitochondrial toxicity | + | 0.7625 | 76.25% |
| Nephrotoxicity | - | 0.5981 | 59.81% |
| Acute Oral Toxicity (c) | III | 0.5035 | 50.35% |
| Estrogen receptor binding | - | 0.6802 | 68.02% |
| Androgen receptor binding | - | 0.7960 | 79.60% |
| Thyroid receptor binding | - | 0.5956 | 59.56% |
| Glucocorticoid receptor binding | - | 0.5176 | 51.76% |
| Aromatase binding | - | 0.5727 | 57.27% |
| PPAR gamma | - | 0.5798 | 57.98% |
| Honey bee toxicity | - | 0.6871 | 68.71% |
| Biodegradation | - | 0.7500 | 75.00% |
| Crustacea aquatic toxicity | + | 0.6700 | 67.00% |
| Fish aquatic toxicity | + | 0.7595 | 75.95% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL4808 | P02708 | Acetylcholine receptor protein alpha chain |
160 nM |
IC50 |
via Super-PRED
|
| CHEMBL3916 | P02718 | Acetylcholine receptor protein delta chain |
200 nM |
EC50 |
via Super-PRED
|
| CHEMBL1907588 | P02708 | Acetylcholine receptor; alpha1/beta1/delta/gamma |
0.053 nM |
EC50 |
via Super-PRED
|
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit |
22 nM 39.81 nM 1.06 nM |
Ki EC50 Kd |
via Super-PRED
via Super-PRED via Super-PRED |
| CHEMBL3068 | P32297 | Neuronal acetylcholine receptor subunit alpha-3 |
7 nM |
EC50 |
via Super-PRED
|
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 |
0.15 nM 0.15 nM |
Ki Ki |
via Super-PRED
via Super-PRED |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 |
0.026 nM 0.03 nM 0.0088 nM |
Ki Kd EC50 |
via Super-PRED
via Super-PRED via Super-PRED |
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 98.44% | 97.09% |
| CHEMBL238 | Q01959 | Dopamine transporter | 93.96% | 95.88% |
| CHEMBL222 | P23975 | Norepinephrine transporter | 93.68% | 96.06% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 93.65% | 97.53% |
| CHEMBL228 | P31645 | Serotonin transporter | 93.15% | 95.51% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.77% | 96.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.28% | 95.89% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.98% | 94.45% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.69% | 94.75% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 85.84% | 92.97% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 85.18% | 94.62% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 82.79% | 95.78% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 82.06% | 89.44% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.75% | 91.11% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.01% | 100.00% |
| CHEMBL3553 | P29597 | Tyrosine-protein kinase TYK2 | 80.95% | 97.09% |
| CHEMBL2850 | P49840 | Glycogen synthase kinase-3 alpha | 80.25% | 88.84% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 44592968 |
| LOTUS | LTS0175886 |
| wikiData | Q104251595 |