(1R,2S,12S,13R)-2,6,10-trimethyl-13-prop-1-en-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-ol
| Internal ID | 0e378d3e-505a-457d-a6f3-1a3d6313f389 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | (1R,2S,12S,13R)-2,6,10-trimethyl-13-prop-1-en-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-ol |
| SMILES (Canonical) | CC1=CCCC(C2CC(C(O2)CC(=CCC1)C)C(=C)C)(C)O |
| SMILES (Isomeric) | CC1=CCC[C@]([C@H]2C[C@@H]([C@@H](O2)CC(=CCC1)C)C(=C)C)(C)O |
| InChI | InChI=1S/C20H32O2/c1-14(2)17-13-19-20(5,21)11-7-10-15(3)8-6-9-16(4)12-18(17)22-19/h9-10,17-19,21H,1,6-8,11-13H2,2-5H3/t17-,18+,19-,20+/m1/s1 |
| InChI Key | CIDFXDBSTSSVAA-WCIQWLHISA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.240230259 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 4.20 |
| There are no found synonyms. |
![2D Structure of (1R,2S,12S,13R)-2,6,10-trimethyl-13-prop-1-en-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-ol](https://plantaedb.com/storage/docs/compounds/2023/11/1r2s12s13r-2610-trimethyl-13-prop-1-en-2-yl-15-oxabicyclo1021pentadeca-59-dien-2-ol.jpg "2D Structure of (1R,2S,12S,13R)-2,6,10-trimethyl-13-prop-1-en-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.94% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.12% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.17% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.48% | 97.09% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 86.25% | 97.79% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 85.35% | 91.49% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.14% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.77% | 94.45% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.35% | 100.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.27% | 96.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.29% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.66% | 90.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.86% | 92.94% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.47% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Morus alba |
| Morus cathayana |
| Morus macroura |
| Morus wittiorum |
| PubChem | 162868745 |
| LOTUS | LTS0205147 |
| wikiData | Q105192320 |