(1R,2S,10S,13S,15S)-13-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-11-one
| Internal ID | 06fdbf48-f46b-4b5b-b7f4-f8806ad2272e |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | (1R,2S,10S,13S,15S)-13-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-11-one |
| SMILES (Canonical) | CC1CC2(CC(=O)C3CCCN4C3(C1)C2CCC4)O |
| SMILES (Isomeric) | C[C@@H]1C[C@@]2(CC(=O)[C@H]3CCCN4[C@]3(C1)[C@@H]2CCC4)O |
| InChI | InChI=1S/C16H25NO2/c1-11-8-15(19)10-13(18)12-4-2-6-17-7-3-5-14(15)16(12,17)9-11/h11-12,14,19H,2-10H2,1H3/t11-,12-,14-,15+,16+/m1/s1 |
| InChI Key | VDFVXSCITSQART-HPCJDURASA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.188529040 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 1.40 |
| There are no found synonyms. |
![2D Structure of (1R,2S,10S,13S,15S)-13-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-11-one](https://plantaedb.com/storage/docs/compounds/2023/11/1r2s10s13s15s-13-hydroxy-15-methyl-6-azatetracyclo8600160213hexadecan-11-one.jpg "2D Structure of (1R,2S,10S,13S,15S)-13-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-11-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.08% | 97.25% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.86% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.86% | 98.95% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 92.27% | 96.77% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.17% | 96.09% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 87.53% | 93.04% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 87.06% | 94.78% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.82% | 95.56% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.50% | 93.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.15% | 97.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.79% | 92.94% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.43% | 100.00% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 84.33% | 90.24% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 84.30% | 86.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.69% | 95.89% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.32% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Huperzia serrata |
| PubChem | 101791470 |
| LOTUS | LTS0169142 |
| wikiData | Q105284136 |