[(1R,2S)-1-(3,4-dihydroxyphenyl)-1,3-dihydroxypropan-2-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate
| Internal ID | cb48fa3c-0dea-4309-bb7c-1ecf47699a6f |
| Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
| IUPAC Name | [(1R,2S)-1-(3,4-dihydroxyphenyl)-1,3-dihydroxypropan-2-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES (Canonical) | C1=CC(=C(C=C1C=CC(=O)OC(CO)C(C2=CC(=C(C=C2)O)O)O)O)O |
| SMILES (Isomeric) | C1=CC(=C(C=C1/C=C/C(=O)O[C@@H](CO)[C@@H](C2=CC(=C(C=C2)O)O)O)O)O |
| InChI | InChI=1S/C18H18O8/c19-9-16(18(25)11-3-5-13(21)15(23)8-11)26-17(24)6-2-10-1-4-12(20)14(22)7-10/h1-8,16,18-23,25H,9H2/b6-2+/t16-,18+/m0/s1 |
| InChI Key | NRVUZQPQUPWBKS-SEGSCTKESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H18O8 |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 362.10016753 g/mol |
| Topological Polar Surface Area (TPSA) | 148.00 Ų |
| XlogP | 1.00 |
| There are no found synonyms. |
![2D Structure of [(1R,2S)-1-(3,4-dihydroxyphenyl)-1,3-dihydroxypropan-2-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/1r2s-1-34-dihydroxyphenyl-13-dihydroxypropan-2-yl-e-3-34-dihydroxyphenylprop-2-enoate.jpg "2D Structure of [(1R,2S)-1-(3,4-dihydroxyphenyl)-1,3-dihydroxypropan-2-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.04% | 91.11% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.40% | 83.82% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.20% | 96.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.68% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.26% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.06% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.92% | 96.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.42% | 91.49% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.55% | 99.17% |
| CHEMBL3194 | P02766 | Transthyretin | 88.88% | 90.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.30% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.02% | 95.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.28% | 99.15% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.19% | 86.92% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 81.33% | 96.12% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 80.23% | 89.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Hypericum sampsonii |
| PubChem | 162892241 |
| LOTUS | LTS0211605 |
| wikiData | Q105184842 |