(1R,2R,9R,10R)-2-hydroxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one
Internal ID | 30ac7419-410a-45c0-95d8-73375e7d4bc5 |
Taxonomy | Alkaloids and derivatives > Lupin alkaloids > Sparteine, lupanine, and related alkaloids |
IUPAC Name | (1R,2R,9R,10R)-2-hydroxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one |
SMILES (Canonical) | C1CCN2CC3CC(C2C1)CN4C3(CCCC4=O)O |
SMILES (Isomeric) | C1CCN2C[C@H]3C[C@@H]([C@H]2C1)CN4[C@]3(CCCC4=O)O |
InChI | InChI=1S/C15H24N2O2/c18-14-5-3-6-15(19)12-8-11(9-17(14)15)13-4-1-2-7-16(13)10-12/h11-13,19H,1-10H2/t11-,12-,13-,15-/m1/s1 |
InChI Key | GNMOLCPEHSMYLC-RGCMKSIDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H24N2O2 |
Molecular Weight | 264.36 g/mol |
Exact Mass | 264.183778013 g/mol |
Topological Polar Surface Area (TPSA) | 43.80 Ų |
XlogP | 0.80 |
There are no found synonyms. |
![2D Structure of (1R,2R,9R,10R)-2-hydroxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one 2D Structure of (1R,2R,9R,10R)-2-hydroxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one](https://plantaedb.com/storage/docs/compounds/2023/11/1r2r9r10r-2-hydroxy-715-diazatetracyclo77102701015heptadecan-6-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.69% | 97.25% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 93.29% | 93.04% |
CHEMBL4235 | P28845 | 11-beta-hydroxysteroid dehydrogenase 1 | 90.11% | 97.98% |
CHEMBL2581 | P07339 | Cathepsin D | 89.56% | 98.95% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 88.61% | 93.03% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 87.88% | 94.23% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.58% | 97.09% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.27% | 93.40% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.86% | 92.94% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.79% | 95.56% |
CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 86.56% | 96.03% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.25% | 94.45% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.84% | 95.50% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 85.75% | 94.78% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.12% | 96.09% |
CHEMBL238 | Q01959 | Dopamine transporter | 85.10% | 95.88% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.90% | 95.89% |
CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 84.56% | 99.29% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.80% | 93.00% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 82.34% | 95.62% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.33% | 90.71% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.04% | 94.08% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.90% | 91.19% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.67% | 100.00% |
CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 81.08% | 91.76% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.69% | 82.69% |
CHEMBL4608 | P33032 | Melanocortin receptor 5 | 80.48% | 97.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Maackia amurensis |
PubChem | 162939756 |
LOTUS | LTS0194904 |
wikiData | Q105012787 |