(1R,2R,7S,8R)-2,6,6-trimethyl-9-methylidenetricyclo[5.4.0.02,8]undecane
| Internal ID | 0bb8a735-44ac-491e-bc95-87a144713441 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Bicyclic monoterpenoids |
| IUPAC Name | (1R,2R,7S,8R)-2,6,6-trimethyl-9-methylidenetricyclo[5.4.0.02,8]undecane |
| SMILES (Canonical) | CC1(CCCC2(C3C1C2C(=C)CC3)C)C |
| SMILES (Isomeric) | C[C@@]12CCCC([C@H]3[C@H]1CCC(=C)[C@H]23)(C)C |
| InChI | InChI=1S/C15H24/c1-10-6-7-11-13-12(10)15(11,4)9-5-8-14(13,2)3/h11-13H,1,5-9H2,2-4H3/t11-,12+,13+,15-/m1/s1 |
| InChI Key | DQOVXHMHLOWECL-UKTARXLSSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 g/mol |
| Exact Mass | 204.187800766 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 4.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.29% | 97.25% |
| CHEMBL4370 | P16662 | UDP-glucuronosyltransferase 2B7 | 92.44% | 100.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.25% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.54% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.49% | 97.09% |
| CHEMBL1871 | P10275 | Androgen Receptor | 86.59% | 96.43% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.17% | 96.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.13% | 92.94% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.91% | 95.89% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 81.84% | 99.18% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 81.31% | 97.79% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.53% | 93.99% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.48% | 95.50% |
| CHEMBL238 | Q01959 | Dopamine transporter | 80.09% | 95.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Artemisia annua |
| Lepidozia fauriana |
| Marsupella emarginata |
| Plagiochasma rupestre |
| PubChem | 154495921 |
| LOTUS | LTS0080386 |
| wikiData | Q104987066 |