(1R,2R,5S,9R,10S,12S)-5,12-dihydroxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one
Internal ID | d8459bd1-3951-4901-882e-0efc18c09665 |
Taxonomy | Alkaloids and derivatives > Lupin alkaloids > Sparteine, lupanine, and related alkaloids |
IUPAC Name | (1R,2R,5S,9R,10S,12S)-5,12-dihydroxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one |
SMILES (Canonical) | C1CC(C(=O)N2C1C3CC(C2)C4CC(CCN4C3)O)O |
SMILES (Isomeric) | C1C[C@@H](C(=O)N2[C@H]1[C@@H]3C[C@H](C2)[C@@H]4C[C@H](CCN4C3)O)O |
InChI | InChI=1S/C15H24N2O3/c18-11-3-4-16-7-9-5-10(13(16)6-11)8-17-12(9)1-2-14(19)15(17)20/h9-14,18-19H,1-8H2/t9-,10-,11+,12-,13+,14+/m1/s1 |
InChI Key | XQOAPEVXJVZPHW-PRFQISJJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H24N2O3 |
Molecular Weight | 280.36 g/mol |
Exact Mass | 280.17869263 g/mol |
Topological Polar Surface Area (TPSA) | 64.00 Ų |
XlogP | 0.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.79% | 91.11% |
CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 88.35% | 91.76% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.73% | 97.25% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.61% | 93.00% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 87.37% | 91.03% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.83% | 97.09% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 86.80% | 93.03% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.26% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 85.27% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.59% | 95.89% |
CHEMBL4235 | P28845 | 11-beta-hydroxysteroid dehydrogenase 1 | 84.09% | 97.98% |
CHEMBL238 | Q01959 | Dopamine transporter | 84.03% | 95.88% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.82% | 96.09% |
CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 83.65% | 96.03% |
CHEMBL1871 | P10275 | Androgen Receptor | 83.30% | 96.43% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 83.17% | 94.78% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.78% | 99.23% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.41% | 94.45% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 81.33% | 98.46% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 81.21% | 98.33% |
CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 80.73% | 96.11% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.70% | 90.71% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.25% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cytisus scoparius |
PubChem | 163002139 |
LOTUS | LTS0208579 |
wikiData | Q105339919 |